C28H33N2O2+ — CID 58325800
[4-[[4-(dimethylamino)phenyl]-[4-(4-oxopentoxy)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium (PubChem CID 58325800) has the molecular formula C28H33N2O2+ and a molecular weight of 429.58 g/mol. Its IUPAC name is [4-[[4-(dimethylamino)phenyl]-[4-(4-oxopentoxy)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium.
| Compound Name | [4-[[4-(dimethylamino)phenyl]-[4-(4-oxopentoxy)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 58325800 |
| Molecular Formula | C28H33N2O2+ |
| Molecular Weight | 429.58 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | [4-[[4-(dimethylamino)phenyl]-[4-(4-oxopentoxy)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
| SMILES | CC(=O)CCCOc1ccc(C(=C2C=CC(=[N+](C)C)C=C2)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C28H33N2O2/c1-21(31)7-6-20-32-27-18-12-24(13-19-27)28(22-8-14-25(15-9-22)29(2)3)23-10-16-26(17-11-23)30(4)5/h8-19H,6-7,20H2,1-5H3/q+1 |
| InChIKey | HBDXGBUMCQOXHV-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 32.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.58 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|