C42H51N4+ — CID 54173125
dimethyl-[4-[(2E,4E)-1,7,7-tris[4-(dimethylamino)phenyl]-2,4,6-trimethylhepta-2,4,6-trienylidene]cyclohexa-2,5-dien-1-ylidene]azanium (PubChem CID 54173125) has the molecular formula C42H51N4+ and a molecular weight of 611.90 g/mol. Its IUPAC name is dimethyl-[4-[(2E,4E)-1,7,7-tris[4-(dimethylamino)phenyl]-2,4,6-trimethylhepta-2,4,6-trienylidene]cyclohexa-2,5-dien-1-ylidene]azanium.
| Compound Name | dimethyl-[4-[(2E,4E)-1,7,7-tris[4-(dimethylamino)phenyl]-2,4,6-trimethylhepta-2,4,6-trienylidene]cyclohexa-2,5-dien-1-ylidene]azanium |
|---|---|
| PubChem CID | 54173125 |
| Molecular Formula | C42H51N4+ |
| Molecular Weight | 611.90 g/mol |
| Exact Mass | 611.41 |
| IUPAC Name | dimethyl-[4-[(2E,4E)-1,7,7-tris[4-(dimethylamino)phenyl]-2,4,6-trimethylhepta-2,4,6-trienylidene]cyclohexa-2,5-dien-1-ylidene]azanium |
| SMILES | CC(/C=C(C)/C=C(\C)C(=C1C=CC(=[N+](C)C)C=C1)c1ccc(N(C)C)cc1)=C(c1ccc(N(C)C)cc1)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C42H51N4/c1-30(28-31(2)41(33-12-20-37(21-13-33)43(4)5)34-14-22-38(23-15-34)44(6)7)29-32(3)42(35-16-24-39(25-17-35)45(8)9)36-18-26-40(27-19-36)46(10)11/h12-29H,1-11H3/q+1 |
| InChIKey | OWKJBXLCUMIING-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 12.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.90 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|