C32H30N+ — CID 58900957
dimethyl-[4-[5-(4-methylphenyl)-1,5-diphenylpenta-2,4-dienylidene]cyclohexa-2,5-dien-1-ylidene]azanium (PubChem CID 58900957) has the molecular formula C32H30N+ and a molecular weight of 428.60 g/mol. Its IUPAC name is dimethyl-[4-[5-(4-methylphenyl)-1,5-diphenylpenta-2,4-dienylidene]cyclohexa-2,5-dien-1-ylidene]azanium.
| Compound Name | dimethyl-[4-[5-(4-methylphenyl)-1,5-diphenylpenta-2,4-dienylidene]cyclohexa-2,5-dien-1-ylidene]azanium |
|---|---|
| PubChem CID | 58900957 |
| Molecular Formula | C32H30N+ |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | dimethyl-[4-[5-(4-methylphenyl)-1,5-diphenylpenta-2,4-dienylidene]cyclohexa-2,5-dien-1-ylidene]azanium |
| SMILES | Cc1ccc(C(=CC=CC(=C2C=CC(=[N+](C)C)C=C2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H30N/c1-25-17-19-28(20-18-25)31(26-11-6-4-7-12-26)15-10-16-32(27-13-8-5-9-14-27)29-21-23-30(24-22-29)33(2)3/h4-24H,1-3H3/q+1 |
| InChIKey | OAQDAPNMFGJLON-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|