C45H60N4 — CID 54225572
N,N-diethyl-4-[1,5,5-tris[4-(diethylamino)phenyl]penta-2,4-dienyl]aniline (PubChem CID 54225572) has the molecular formula C45H60N4 and a molecular weight of 657.00 g/mol. Its IUPAC name is N,N-diethyl-4-[1,5,5-tris[4-(diethylamino)phenyl]penta-2,4-dienyl]aniline.
| Compound Name | N,N-diethyl-4-[1,5,5-tris[4-(diethylamino)phenyl]penta-2,4-dienyl]aniline |
|---|---|
| PubChem CID | 54225572 |
| Molecular Formula | C45H60N4 |
| Molecular Weight | 657.00 g/mol |
| Exact Mass | 656.48 |
| IUPAC Name | N,N-diethyl-4-[1,5,5-tris[4-(diethylamino)phenyl]penta-2,4-dienyl]aniline |
| SMILES | CCN(CC)c1ccc(C(=CC=CC(c2ccc(N(CC)CC)cc2)c2ccc(N(CC)CC)cc2)c2ccc(N(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C45H60N4/c1-9-46(10-2)40-28-20-36(21-29-40)44(37-22-30-41(31-23-37)47(11-3)12-4)18-17-19-45(38-24-32-42(33-25-38)48(13-5)14-6)39-26-34-43(35-27-39)49(15-7)16-8/h17-35,44H,9-16H2,1-8H3 |
| InChIKey | QFPMUPLNZHSETN-UHFFFAOYSA-N |
| XLogP | 10.89 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.00 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|