C36H44N3+ — CID 59104854
[4-[[4-(diethylamino)phenyl]-[(9Z)-4-(ethylamino)-8H-benzo[8]annulen-1-yl]methylidene]cyclohexa-2,5-dien-1-ylidene]-ethyl-propylazanium (PubChem CID 59104854) has the molecular formula C36H44N3+ and a molecular weight of 518.77 g/mol. Its IUPAC name is [4-[[4-(diethylamino)phenyl]-[(9Z)-4-(ethylamino)-8H-benzo[8]annulen-1-yl]methylidene]cyclohexa-2,5-dien-1-ylidene]-ethyl-propylazanium.
| Compound Name | [4-[[4-(diethylamino)phenyl]-[(9Z)-4-(ethylamino)-8H-benzo[8]annulen-1-yl]methylidene]cyclohexa-2,5-dien-1-ylidene]-ethyl-propylazanium |
|---|---|
| PubChem CID | 59104854 |
| Molecular Formula | C36H44N3+ |
| Molecular Weight | 518.77 g/mol |
| Exact Mass | 518.35 |
| IUPAC Name | [4-[[4-(diethylamino)phenyl]-[(9Z)-4-(ethylamino)-8H-benzo[8]annulen-1-yl]methylidene]cyclohexa-2,5-dien-1-ylidene]-ethyl-propylazanium |
| SMILES | CCC[N+](CC)=C1C=CC(=C(c2ccc(N(CC)CC)cc2)c2ccc(NCC)c3c2/C=C\CC=C=C3)C=C1 |
| InChI | InChI=1S/C36H43N3/c1-6-27-39(10-5)31-23-19-29(20-24-31)36(28-17-21-30(22-18-28)38(8-3)9-4)34-25-26-35(37-7-2)33-16-14-12-11-13-15-32(33)34/h12-13,15-26H,6-11,27H2,1-5H3/p+1/b15-13- |
| InChIKey | OFZMQFCMDMCDJU-SQFISAMPSA-O |
| XLogP | 8.36 |
| TPSA | 18.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.77 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|