C21H21N3 — CID 101427600
4-[[4-(methylamino)phenyl]-(4-methyliminocyclohexa-2,5-dien-1-ylidene)methyl]aniline (PubChem CID 101427600) has the molecular formula C21H21N3 and a molecular weight of 315.42 g/mol. Its IUPAC name is 4-[[4-(methylamino)phenyl]-(4-methyliminocyclohexa-2,5-dien-1-ylidene)methyl]aniline.
| Compound Name | 4-[[4-(methylamino)phenyl]-(4-methyliminocyclohexa-2,5-dien-1-ylidene)methyl]aniline |
|---|---|
| PubChem CID | 101427600 |
| Molecular Formula | C21H21N3 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 4-[[4-(methylamino)phenyl]-(4-methyliminocyclohexa-2,5-dien-1-ylidene)methyl]aniline |
| SMILES | CN=C1C=CC(=C(c2ccc(N)cc2)c2ccc(NC)cc2)C=C1 |
| InChI | InChI=1S/C21H21N3/c1-23-19-11-5-16(6-12-19)21(15-3-9-18(22)10-4-15)17-7-13-20(24-2)14-8-17/h3-14,23H,22H2,1-2H3/b21-17-,24-20+ |
| InChIKey | CNKFWWMWHWBHBX-RABDINPKSA-N |
| XLogP | 4.31 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|