C21H22N3+ — CID 6426936
[(4Z)-4-[(4-amino-3-methylphenyl)-(4-aminophenyl)methylidene]-2-methylcyclohexa-2,5-dien-1-ylidene]azanium (PubChem CID 6426936) has the molecular formula C21H22N3+ and a molecular weight of 316.43 g/mol. Its IUPAC name is [(4Z)-4-[(4-amino-3-methylphenyl)-(4-aminophenyl)methylidene]-2-methylcyclohexa-2,5-dien-1-ylidene]azanium.
| Compound Name | [(4Z)-4-[(4-amino-3-methylphenyl)-(4-aminophenyl)methylidene]-2-methylcyclohexa-2,5-dien-1-ylidene]azanium |
|---|---|
| PubChem CID | 6426936 |
| Molecular Formula | C21H22N3+ |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | [(4Z)-4-[(4-amino-3-methylphenyl)-(4-aminophenyl)methylidene]-2-methylcyclohexa-2,5-dien-1-ylidene]azanium |
| SMILES | CC1=C/C(=C(/c2ccc(N)cc2)c2ccc(N)c(C)c2)C=CC1=[NH2+] |
| InChI | InChI=1S/C21H21N3/c1-13-11-16(5-9-19(13)23)21(15-3-7-18(22)8-4-15)17-6-10-20(24)14(2)12-17/h3-12,23H,22,24H2,1-2H3/p+1/b21-16-,23-19? |
| InChIKey | RJAMLLTWCQCKGI-CYYCFYCUSA-O |
| XLogP | 2.68 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|