C22H26N3+ — CID 20634085
[4-[bis(4-amino-3-methylphenyl)methylidene]-2-methylcyclohexa-2,5-dien-1-yl]azanium (PubChem CID 20634085) has the molecular formula C22H26N3+ and a molecular weight of 332.47 g/mol. Its IUPAC name is [4-[bis(4-amino-3-methylphenyl)methylidene]-2-methylcyclohexa-2,5-dien-1-yl]azanium.
| Compound Name | [4-[bis(4-amino-3-methylphenyl)methylidene]-2-methylcyclohexa-2,5-dien-1-yl]azanium |
|---|---|
| PubChem CID | 20634085 |
| Molecular Formula | C22H26N3+ |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | [4-[bis(4-amino-3-methylphenyl)methylidene]-2-methylcyclohexa-2,5-dien-1-yl]azanium |
| SMILES | CC1=CC(=C(c2ccc(N)c(C)c2)c2ccc(N)c(C)c2)C=CC1[NH3+] |
| InChI | InChI=1S/C22H25N3/c1-13-10-16(4-7-19(13)23)22(17-5-8-20(24)14(2)11-17)18-6-9-21(25)15(3)12-18/h4-12,19H,23-25H2,1-3H3/p+1 |
| InChIKey | OOSIWXXPHREVPL-UHFFFAOYSA-O |
| XLogP | 3.40 |
| TPSA | 79.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|