About ethane;4-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-2-methylaniline;methane
ethane;4-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-2-methylaniline;methane (PubChem CID 143935348) has the molecular formula C16H24FN
and a molecular weight of 249.37 g/mol. Its IUPAC name is ethane;4-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-2-methylaniline;methane.
Molecular Properties
| Compound Name | ethane;4-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-2-methylaniline;methane |
| PubChem CID | 143935348 |
| Molecular Formula | C16H24FN |
| Molecular Weight | 249.37 g/mol |
| Exact Mass | 249.19 |
| IUPAC Name | ethane;4-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-2-methylaniline;methane |
| SMILES | C.C=C(F)/C=C\C(=C)c1ccc(N)c(C)c1.CC |
| InChI | InChI=1S/C13H14FN.C2H6.CH4/c1-9(4-5-11(3)14)12-6-7-13(15)10(2)8-12;1-2;/h4-8H,1,3,15H2,2H3;1-2H3;1H4/b5-4-;; |
| InChIKey | SOTRJVJQIOBARW-WNCVTPEDSA-N |
| XLogP | 5.29 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 249.37 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-2-methylaniline;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-2-methylaniline;methane?
The IUPAC name of ethane;4-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-2-methylaniline;methane (CID 143935348) is ethane;4-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-2-methylaniline;methane.
What is the SMILES notation for ethane;4-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-2-methylaniline;methane?
The canonical SMILES for ethane;4-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-2-methylaniline;methane is C.C=C(F)/C=C\C(=C)c1ccc(N)c(C)c1.CC.
What is the InChIKey of ethane;4-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-2-methylaniline;methane?
The InChIKey is SOTRJVJQIOBARW-WNCVTPEDSA-N. The full InChI is InChI=1S/C13H14FN.C2H6.CH4/c1-9(4-5-11(3)14)12-6-7-13(15)10(2)8-12;1-2;/h4-8H,1,3,15H2,2H3;1-2H3;1H4/b5-4-;;.
What are the key properties of ethane;4-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-2-methylaniline;methane?
ethane;4-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-2-methylaniline;methane has a molecular weight of 249.37 g/mol, XLogP of 5.29, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-2-methylaniline;methane is sourced from PubChem (CID 143935348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).