C20H22N2 — CID 143237112
(2Z)-4-(3,4-dimethylphenyl)-N'-methyl-N-phenylpenta-2,4-dienimidamide (PubChem CID 143237112) has the molecular formula C20H22N2 and a molecular weight of 290.41 g/mol. Its IUPAC name is (2Z)-4-(3,4-dimethylphenyl)-N'-methyl-N-phenylpenta-2,4-dienimidamide.
| Compound Name | (2Z)-4-(3,4-dimethylphenyl)-N'-methyl-N-phenylpenta-2,4-dienimidamide |
|---|---|
| PubChem CID | 143237112 |
| Molecular Formula | C20H22N2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | (2Z)-4-(3,4-dimethylphenyl)-N'-methyl-N-phenylpenta-2,4-dienimidamide |
| SMILES | C=C(/C=C\C(=N\C)Nc1ccccc1)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C20H22N2/c1-15-10-12-18(14-17(15)3)16(2)11-13-20(21-4)22-19-8-6-5-7-9-19/h5-14H,2H2,1,3-4H3,(H,21,22)/b13-11- |
| InChIKey | ROVRPCUYGNSCNM-QBFSEMIESA-N |
| XLogP | 5.01 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|