C19H24N3O+ — CID 21440580
1-[4-[(3,4-dimethylbenzoyl)amino]anilino]ethylidene-dimethylazanium (PubChem CID 21440580) has the molecular formula C19H24N3O+ and a molecular weight of 310.42 g/mol. Its IUPAC name is 1-[4-[(3,4-dimethylbenzoyl)amino]anilino]ethylidene-dimethylazanium.
| Compound Name | 1-[4-[(3,4-dimethylbenzoyl)amino]anilino]ethylidene-dimethylazanium |
|---|---|
| PubChem CID | 21440580 |
| Molecular Formula | C19H24N3O+ |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 1-[4-[(3,4-dimethylbenzoyl)amino]anilino]ethylidene-dimethylazanium |
| SMILES | CC(Nc1ccc(NC(=O)c2ccc(C)c(C)c2)cc1)=[N+](C)C |
| InChI | InChI=1S/C19H23N3O/c1-13-6-7-16(12-14(13)2)19(23)21-18-10-8-17(9-11-18)20-15(3)22(4)5/h6-12H,1-5H3,(H,21,23)/p+1 |
| InChIKey | ACIDSXORGGPWMQ-UHFFFAOYSA-O |
| XLogP | 3.66 |
| TPSA | 44.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|