C23H22N2O2 — CID 112988131
N-[4-(3-acetylanilino)phenyl]-3,4-dimethylbenzamide (PubChem CID 112988131) has the molecular formula C23H22N2O2 and a molecular weight of 358.44 g/mol. Its IUPAC name is N-[4-(3-acetylanilino)phenyl]-3,4-dimethylbenzamide.
| Compound Name | N-[4-(3-acetylanilino)phenyl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 112988131 |
| Molecular Formula | C23H22N2O2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | N-[4-(3-acetylanilino)phenyl]-3,4-dimethylbenzamide |
| SMILES | CC(=O)c1cccc(Nc2ccc(NC(=O)c3ccc(C)c(C)c3)cc2)c1 |
| InChI | InChI=1S/C23H22N2O2/c1-15-7-8-19(13-16(15)2)23(27)25-21-11-9-20(10-12-21)24-22-6-4-5-18(14-22)17(3)26/h4-14,24H,1-3H3,(H,25,27) |
| InChIKey | KNGNTUVNKSAVNG-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |