C26H35N3O — CID 143995314
1-(3,4-dimethylphenyl)-N-methylethanimine;(Z)-5-(3-methylanilino)-4-(prop-1-en-2-ylamino)pent-3-en-2-one (PubChem CID 143995314) has the molecular formula C26H35N3O and a molecular weight of 405.59 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-N-methylethanimine;(Z)-5-(3-methylanilino)-4-(prop-1-en-2-ylamino)pent-3-en-2-one.
| Compound Name | 1-(3,4-dimethylphenyl)-N-methylethanimine;(Z)-5-(3-methylanilino)-4-(prop-1-en-2-ylamino)pent-3-en-2-one |
|---|---|
| PubChem CID | 143995314 |
| Molecular Formula | C26H35N3O |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.28 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-N-methylethanimine;(Z)-5-(3-methylanilino)-4-(prop-1-en-2-ylamino)pent-3-en-2-one |
| SMILES | C/N=C(\C)c1ccc(C)c(C)c1.C=C(C)N/C(=C\C(C)=O)CNc1cccc(C)c1 |
| InChI | InChI=1S/C15H20N2O.C11H15N/c1-11(2)17-15(9-13(4)18)10-16-14-7-5-6-12(3)8-14;1-8-5-6-11(7-9(8)2)10(3)12-4/h5-9,16-17H,1,10H2,2-4H3;5-7H,1-4H3/b15-9-;12-10+ |
| InChIKey | QMEJIGLCLHSQPF-CFICJORQSA-N |
| XLogP | 5.75 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|