C20H25N3O — CID 6075641
2-(3-methylanilino)-N-[(Z)-1-(4-propan-2-ylphenyl)ethylideneamino]acetamide (PubChem CID 6075641) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is 2-(3-methylanilino)-N-[(Z)-1-(4-propan-2-ylphenyl)ethylideneamino]acetamide.
| Compound Name | 2-(3-methylanilino)-N-[(Z)-1-(4-propan-2-ylphenyl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 6075641 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 2-(3-methylanilino)-N-[(Z)-1-(4-propan-2-ylphenyl)ethylideneamino]acetamide |
| SMILES | C/C(=N/NC(=O)CNc1cccc(C)c1)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C20H25N3O/c1-14(2)17-8-10-18(11-9-17)16(4)22-23-20(24)13-21-19-7-5-6-15(3)12-19/h5-12,14,21H,13H2,1-4H3,(H,23,24)/b22-16- |
| InChIKey | JYWHNVCTMTULQA-JWGURIENSA-N |
| XLogP | 4.07 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|