C19H20FN3O2 — CID 4033970
N'-[1-(4-fluorophenyl)ethylideneamino]-N-(3-methylphenyl)butanediamide (PubChem CID 4033970) has the molecular formula C19H20FN3O2 and a molecular weight of 341.39 g/mol. Its IUPAC name is N'-[1-(4-fluorophenyl)ethylideneamino]-N-(3-methylphenyl)butanediamide.
| Compound Name | N'-[1-(4-fluorophenyl)ethylideneamino]-N-(3-methylphenyl)butanediamide |
|---|---|
| PubChem CID | 4033970 |
| Molecular Formula | C19H20FN3O2 |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | N'-[1-(4-fluorophenyl)ethylideneamino]-N-(3-methylphenyl)butanediamide |
| SMILES | CC(=NNC(=O)CCC(=O)Nc1cccc(C)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H20FN3O2/c1-13-4-3-5-17(12-13)21-18(24)10-11-19(25)23-22-14(2)15-6-8-16(20)9-7-15/h3-9,12H,10-11H2,1-2H3,(H,21,24)(H,23,25) |
| InChIKey | ZHCWHXJLXSSMNM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|