C19H19FIN3O2 — CID 2847008
N'-[1-(4-fluorophenyl)ethylideneamino]-N-(4-iodo-2-methylphenyl)butanediamide (PubChem CID 2847008) has the molecular formula C19H19FIN3O2 and a molecular weight of 467.28 g/mol. Its IUPAC name is N'-[1-(4-fluorophenyl)ethylideneamino]-N-(4-iodo-2-methylphenyl)butanediamide.
| Compound Name | N'-[1-(4-fluorophenyl)ethylideneamino]-N-(4-iodo-2-methylphenyl)butanediamide |
|---|---|
| PubChem CID | 2847008 |
| Molecular Formula | C19H19FIN3O2 |
| Molecular Weight | 467.28 g/mol |
| Exact Mass | 467.05 |
| IUPAC Name | N'-[1-(4-fluorophenyl)ethylideneamino]-N-(4-iodo-2-methylphenyl)butanediamide |
| SMILES | CC(=NNC(=O)CCC(=O)Nc1ccc(I)cc1C)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H19FIN3O2/c1-12-11-16(21)7-8-17(12)22-18(25)9-10-19(26)24-23-13(2)14-3-5-15(20)6-4-14/h3-8,11H,9-10H2,1-2H3,(H,22,25)(H,24,26) |
| InChIKey | OZDQAFHJYUIYCB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.28 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|