C20H22N4O4 — CID 3352206
N-(2,4-dimethylphenyl)-N'-[1-(4-nitrophenyl)ethylideneamino]butanediamide (PubChem CID 3352206) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-N'-[1-(4-nitrophenyl)ethylideneamino]butanediamide.
| Compound Name | N-(2,4-dimethylphenyl)-N'-[1-(4-nitrophenyl)ethylideneamino]butanediamide |
|---|---|
| PubChem CID | 3352206 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | N-(2,4-dimethylphenyl)-N'-[1-(4-nitrophenyl)ethylideneamino]butanediamide |
| SMILES | CC(=NNC(=O)CCC(=O)Nc1ccc(C)cc1C)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H22N4O4/c1-13-4-9-18(14(2)12-13)21-19(25)10-11-20(26)23-22-15(3)16-5-7-17(8-6-16)24(27)28/h4-9,12H,10-11H2,1-3H3,(H,21,25)(H,23,26) |
| InChIKey | PJTJRYYCWORHOR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|