C28H35N3 — CID 59057682
N-propyl-4-[[4-(propylamino)phenyl]-(4-propyliminocyclohexa-2,5-dien-1-ylidene)methyl]aniline (PubChem CID 59057682) has the molecular formula C28H35N3 and a molecular weight of 413.61 g/mol. Its IUPAC name is N-propyl-4-[[4-(propylamino)phenyl]-(4-propyliminocyclohexa-2,5-dien-1-ylidene)methyl]aniline.
| Compound Name | N-propyl-4-[[4-(propylamino)phenyl]-(4-propyliminocyclohexa-2,5-dien-1-ylidene)methyl]aniline |
|---|---|
| PubChem CID | 59057682 |
| Molecular Formula | C28H35N3 |
| Molecular Weight | 413.61 g/mol |
| Exact Mass | 413.28 |
| IUPAC Name | N-propyl-4-[[4-(propylamino)phenyl]-(4-propyliminocyclohexa-2,5-dien-1-ylidene)methyl]aniline |
| SMILES | CCCN=C1C=CC(=C(c2ccc(NCCC)cc2)c2ccc(NCCC)cc2)C=C1 |
| InChI | InChI=1S/C28H35N3/c1-4-19-29-25-13-7-22(8-14-25)28(23-9-15-26(16-10-23)30-20-5-2)24-11-17-27(18-12-24)31-21-6-3/h7-18,29-30H,4-6,19-21H2,1-3H3 |
| InChIKey | UXURCVKTGQUHLW-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.61 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|