C22H22N2 — CID 23845295
4-[(4-iminocyclohexa-2,5-dien-1-ylidene)-(4-propylphenyl)methyl]aniline (PubChem CID 23845295) has the molecular formula C22H22N2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 4-[(4-iminocyclohexa-2,5-dien-1-ylidene)-(4-propylphenyl)methyl]aniline.
| Compound Name | 4-[(4-iminocyclohexa-2,5-dien-1-ylidene)-(4-propylphenyl)methyl]aniline |
|---|---|
| PubChem CID | 23845295 |
| Molecular Formula | C22H22N2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 4-[(4-iminocyclohexa-2,5-dien-1-ylidene)-(4-propylphenyl)methyl]aniline |
| SMILES | [H]N=C1C=CC(=C(c2ccc(N)cc2)c2ccc(CCC)cc2)C=C1 |
| InChI | InChI=1S/C22H22N2/c1-2-3-16-4-6-17(7-5-16)22(18-8-12-20(23)13-9-18)19-10-14-21(24)15-11-19/h4-15,23H,2-3,24H2,1H3/b22-18-,23-20+ |
| InChIKey | FHUVDWFXNLYPJH-ZOQFAHOPSA-N |
| XLogP | 5.17 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|