C14H14N2O — CID 15123516
4-N-(4-ethoxyphenyl)cyclohexa-2,5-diene-1,4-diimine (PubChem CID 15123516) has the molecular formula C14H14N2O and a molecular weight of 226.28 g/mol. Its IUPAC name is 4-N-(4-ethoxyphenyl)cyclohexa-2,5-diene-1,4-diimine.
| Compound Name | 4-N-(4-ethoxyphenyl)cyclohexa-2,5-diene-1,4-diimine |
|---|---|
| PubChem CID | 15123516 |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 4-N-(4-ethoxyphenyl)cyclohexa-2,5-diene-1,4-diimine |
| SMILES | [H]N=C1C=CC(=Nc2ccc(OCC)cc2)C=C1 |
| InChI | InChI=1S/C14H14N2O/c1-2-17-14-9-7-13(8-10-14)16-12-5-3-11(15)4-6-12/h3-10,15H,2H2,1H3/b15-11-,16-12+ |
| InChIKey | PDMXCAQQODZXNU-UKVBVZPVSA-N |
| XLogP | 3.30 |
| TPSA | 45.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|