C33H44N2O3S — CID 54048564
N-[4-(4-hexoxyphenyl)iminocyclohexa-2,5-dien-1-ylidene]-2,4,6-tri(propan-2-yl)benzenesulfonamide (PubChem CID 54048564) has the molecular formula C33H44N2O3S and a molecular weight of 548.79 g/mol. Its IUPAC name is N-[4-(4-hexoxyphenyl)iminocyclohexa-2,5-dien-1-ylidene]-2,4,6-tri(propan-2-yl)benzenesulfonamide.
| Compound Name | N-[4-(4-hexoxyphenyl)iminocyclohexa-2,5-dien-1-ylidene]-2,4,6-tri(propan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 54048564 |
| Molecular Formula | C33H44N2O3S |
| Molecular Weight | 548.79 g/mol |
| Exact Mass | 548.31 |
| IUPAC Name | N-[4-(4-hexoxyphenyl)iminocyclohexa-2,5-dien-1-ylidene]-2,4,6-tri(propan-2-yl)benzenesulfonamide |
| SMILES | CCCCCCOc1ccc(N=C2C=CC(=NS(=O)(=O)c3c(C(C)C)cc(C(C)C)cc3C(C)C)C=C2)cc1 |
| InChI | InChI=1S/C33H44N2O3S/c1-8-9-10-11-20-38-30-18-16-28(17-19-30)34-27-12-14-29(15-13-27)35-39(36,37)33-31(24(4)5)21-26(23(2)3)22-32(33)25(6)7/h12-19,21-25H,8-11,20H2,1-7H3/b34-27-,35-29+ |
| InChIKey | LRGPVXYHCVTHCB-YCKPUNAVSA-N |
| XLogP | 9.04 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.79 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|