C44H56N4O8S2 — CID 54293937
ethyl 2-[3-[[2-(4-hexoxyanilino)-5-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]phenyl]carbamoyl]phenyl]sulfonyliminoacetate (PubChem CID 54293937) has the molecular formula C44H56N4O8S2 and a molecular weight of 833.09 g/mol. Its IUPAC name is ethyl 2-[3-[[2-(4-hexoxyanilino)-5-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]phenyl]carbamoyl]phenyl]sulfonyliminoacetate.
| Compound Name | ethyl 2-[3-[[2-(4-hexoxyanilino)-5-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]phenyl]carbamoyl]phenyl]sulfonyliminoacetate |
|---|---|
| PubChem CID | 54293937 |
| Molecular Formula | C44H56N4O8S2 |
| Molecular Weight | 833.09 g/mol |
| Exact Mass | 832.35 |
| IUPAC Name | ethyl 2-[3-[[2-(4-hexoxyanilino)-5-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]phenyl]carbamoyl]phenyl]sulfonyliminoacetate |
| SMILES | CCCCCCOc1ccc(Nc2ccc(NS(=O)(=O)c3c(C(C)C)cc(C(C)C)cc3C(C)C)cc2NC(=O)c2cccc(S(=O)(=O)N=CC(=O)OCC)c2)cc1 |
| InChI | InChI=1S/C44H56N4O8S2/c1-9-11-12-13-23-56-36-20-17-34(18-21-36)46-40-22-19-35(48-58(53,54)43-38(30(5)6)25-33(29(3)4)26-39(43)31(7)8)27-41(40)47-44(50)32-15-14-16-37(24-32)57(51,52)45-28-42(49)55-10-2/h14-22,24-31,46,48H,9-13,23H2,1-8H3,(H,47,50) |
| InChIKey | RZLSCMAXKHLLFQ-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 169.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.09 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|