C37H55N3O3S — CID 70490486
N-[4-(4-methoxy-2-methylanilino)-3-(octylamino)phenyl]-2,4,6-tri(propan-2-yl)benzenesulfonamide (PubChem CID 70490486) has the molecular formula C37H55N3O3S and a molecular weight of 621.93 g/mol. Its IUPAC name is N-[4-(4-methoxy-2-methylanilino)-3-(octylamino)phenyl]-2,4,6-tri(propan-2-yl)benzenesulfonamide.
| Compound Name | N-[4-(4-methoxy-2-methylanilino)-3-(octylamino)phenyl]-2,4,6-tri(propan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 70490486 |
| Molecular Formula | C37H55N3O3S |
| Molecular Weight | 621.93 g/mol |
| Exact Mass | 621.40 |
| IUPAC Name | N-[4-(4-methoxy-2-methylanilino)-3-(octylamino)phenyl]-2,4,6-tri(propan-2-yl)benzenesulfonamide |
| SMILES | CCCCCCCCNc1cc(NS(=O)(=O)c2c(C(C)C)cc(C(C)C)cc2C(C)C)ccc1Nc1ccc(OC)cc1C |
| InChI | InChI=1S/C37H55N3O3S/c1-10-11-12-13-14-15-20-38-36-24-30(16-18-35(36)39-34-19-17-31(43-9)21-28(34)8)40-44(41,42)37-32(26(4)5)22-29(25(2)3)23-33(37)27(6)7/h16-19,21-27,38-40H,10-15,20H2,1-9H3 |
| InChIKey | VYUWXRLJBUYXAD-UHFFFAOYSA-N |
| XLogP | 10.69 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.93 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|