C34H48N2O5S2 — CID 54256204
N-[4-(4-hexoxyanilino)-2-methylsulfonylphenyl]-2,4,6-tri(propan-2-yl)benzenesulfonamide (PubChem CID 54256204) has the molecular formula C34H48N2O5S2 and a molecular weight of 628.90 g/mol. Its IUPAC name is N-[4-(4-hexoxyanilino)-2-methylsulfonylphenyl]-2,4,6-tri(propan-2-yl)benzenesulfonamide.
| Compound Name | N-[4-(4-hexoxyanilino)-2-methylsulfonylphenyl]-2,4,6-tri(propan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 54256204 |
| Molecular Formula | C34H48N2O5S2 |
| Molecular Weight | 628.90 g/mol |
| Exact Mass | 628.30 |
| IUPAC Name | N-[4-(4-hexoxyanilino)-2-methylsulfonylphenyl]-2,4,6-tri(propan-2-yl)benzenesulfonamide |
| SMILES | CCCCCCOc1ccc(Nc2ccc(NS(=O)(=O)c3c(C(C)C)cc(C(C)C)cc3C(C)C)c(S(C)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C34H48N2O5S2/c1-9-10-11-12-19-41-29-16-13-27(14-17-29)35-28-15-18-32(33(22-28)42(8,37)38)36-43(39,40)34-30(24(4)5)20-26(23(2)3)21-31(34)25(6)7/h13-18,20-25,35-36H,9-12,19H2,1-8H3 |
| InChIKey | RAGIVMSSQGYBNU-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.90 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|