About 2-(4-ethoxyphenyl)-1,1,3,3-tetramethylguanidine
2-(4-ethoxyphenyl)-1,1,3,3-tetramethylguanidine (PubChem CID 525247) has the molecular formula C13H21N3O
and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-1,1,3,3-tetramethylguanidine.
Molecular Properties
| Compound Name | 2-(4-ethoxyphenyl)-1,1,3,3-tetramethylguanidine |
| PubChem CID | 525247 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 2-(4-ethoxyphenyl)-1,1,3,3-tetramethylguanidine |
| SMILES | CCOc1ccc(N=C(N(C)C)N(C)C)cc1 |
| InChI | InChI=1S/C13H21N3O/c1-6-17-12-9-7-11(8-10-12)14-13(15(2)3)16(4)5/h7-10H,6H2,1-5H3 |
| InChIKey | HBZBTDXIKBUTFJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-ethoxyphenyl)-1,1,3,3-tetramethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethoxyphenyl)-1,1,3,3-tetramethylguanidine?
The IUPAC name of 2-(4-ethoxyphenyl)-1,1,3,3-tetramethylguanidine (CID 525247) is 2-(4-ethoxyphenyl)-1,1,3,3-tetramethylguanidine.
What is the SMILES notation for 2-(4-ethoxyphenyl)-1,1,3,3-tetramethylguanidine?
The canonical SMILES for 2-(4-ethoxyphenyl)-1,1,3,3-tetramethylguanidine is CCOc1ccc(N=C(N(C)C)N(C)C)cc1.
What is the InChIKey of 2-(4-ethoxyphenyl)-1,1,3,3-tetramethylguanidine?
The InChIKey is HBZBTDXIKBUTFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O/c1-6-17-12-9-7-11(8-10-12)14-13(15(2)3)16(4)5/h7-10H,6H2,1-5H3.
What are the key properties of 2-(4-ethoxyphenyl)-1,1,3,3-tetramethylguanidine?
2-(4-ethoxyphenyl)-1,1,3,3-tetramethylguanidine has a molecular weight of 235.33 g/mol, XLogP of 2.20, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethoxyphenyl)-1,1,3,3-tetramethylguanidine is sourced from PubChem (CID 525247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).