C16H18N2 — CID 54524223
1-N-butyl-4-N-phenylcyclohexa-2,5-diene-1,4-diimine (PubChem CID 54524223) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 1-N-butyl-4-N-phenylcyclohexa-2,5-diene-1,4-diimine.
| Compound Name | 1-N-butyl-4-N-phenylcyclohexa-2,5-diene-1,4-diimine |
|---|---|
| PubChem CID | 54524223 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 1-N-butyl-4-N-phenylcyclohexa-2,5-diene-1,4-diimine |
| SMILES | CCCCN=C1C=CC(=Nc2ccccc2)C=C1 |
| InChI | InChI=1S/C16H18N2/c1-2-3-13-17-14-9-11-16(12-10-14)18-15-7-5-4-6-8-15/h4-12H,2-3,13H2,1H3/b17-14-,18-16+ |
| InChIKey | YRZFKLFEZZLQLO-PUZBGTOPSA-N |
| XLogP | 4.13 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|