C30H46N2S — CID 134937614
2-decylsulfanyl-1-N-octan-2-yl-4-N-phenylcyclohexa-2,5-diene-1,4-diimine (PubChem CID 134937614) has the molecular formula C30H46N2S and a molecular weight of 466.78 g/mol. Its IUPAC name is 2-decylsulfanyl-1-N-octan-2-yl-4-N-phenylcyclohexa-2,5-diene-1,4-diimine.
| Compound Name | 2-decylsulfanyl-1-N-octan-2-yl-4-N-phenylcyclohexa-2,5-diene-1,4-diimine |
|---|---|
| PubChem CID | 134937614 |
| Molecular Formula | C30H46N2S |
| Molecular Weight | 466.78 g/mol |
| Exact Mass | 466.34 |
| IUPAC Name | 2-decylsulfanyl-1-N-octan-2-yl-4-N-phenylcyclohexa-2,5-diene-1,4-diimine |
| SMILES | CCCCCCCCCCSC1=C/C(=N/c2ccccc2)C=C/C1=N\C(C)CCCCCC |
| InChI | InChI=1S/C30H46N2S/c1-4-6-8-10-11-12-13-18-24-33-30-25-28(32-27-20-16-14-17-21-27)22-23-29(30)31-26(3)19-15-9-7-5-2/h14,16-17,20-23,25-26H,4-13,15,18-19,24H2,1-3H3/b31-29+,32-28+ |
| InChIKey | UYZZVMGYCFAPTD-FUNWONRRSA-N |
| XLogP | 9.89 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.78 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|