C18H15N2+ — CID 140581401
phenyl-(4-phenyliminocyclohexa-2,5-dien-1-ylidene)azanium (PubChem CID 140581401) has the molecular formula C18H15N2+ and a molecular weight of 259.33 g/mol. Its IUPAC name is phenyl-(4-phenyliminocyclohexa-2,5-dien-1-ylidene)azanium.
| Compound Name | phenyl-(4-phenyliminocyclohexa-2,5-dien-1-ylidene)azanium |
|---|---|
| PubChem CID | 140581401 |
| Molecular Formula | C18H15N2+ |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | phenyl-(4-phenyliminocyclohexa-2,5-dien-1-ylidene)azanium |
| SMILES | C1=CC(=[NH+]c2ccccc2)C=CC1=Nc1ccccc1 |
| InChI | InChI=1S/C18H14N2/c1-3-7-15(8-4-1)19-17-11-13-18(14-12-17)20-16-9-5-2-6-10-16/h1-14H/p+1/b19-17-,20-18+ |
| InChIKey | QLSPXVTVRFSANN-YAFCTCPESA-O |
| XLogP | 2.74 |
| TPSA | 26.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|