C30H20N4S2 — CID 132962070
(2E)-N,4-diphenyl-2-(4-phenyl-5-phenylimino-1,3-thiazol-2-ylidene)-1,3-thiazol-5-imine (PubChem CID 132962070) has the molecular formula C30H20N4S2 and a molecular weight of 500.65 g/mol. Its IUPAC name is (2E)-N,4-diphenyl-2-(4-phenyl-5-phenylimino-1,3-thiazol-2-ylidene)-1,3-thiazol-5-imine.
| Compound Name | (2E)-N,4-diphenyl-2-(4-phenyl-5-phenylimino-1,3-thiazol-2-ylidene)-1,3-thiazol-5-imine |
|---|---|
| PubChem CID | 132962070 |
| Molecular Formula | C30H20N4S2 |
| Molecular Weight | 500.65 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | (2E)-N,4-diphenyl-2-(4-phenyl-5-phenylimino-1,3-thiazol-2-ylidene)-1,3-thiazol-5-imine |
| SMILES | c1ccc(/N=C2\S/C(=C3\N=C(c4ccccc4)/C(=N/c4ccccc4)S3)N=C2c2ccccc2)cc1 |
| InChI | InChI=1S/C30H20N4S2/c1-5-13-21(14-6-1)25-27(31-23-17-9-3-10-18-23)35-29(33-25)30-34-26(22-15-7-2-8-16-22)28(36-30)32-24-19-11-4-12-20-24/h1-20H/b30-29+,31-27-,32-28- |
| InChIKey | JABDCNNJMJPSDI-MZBVAFMESA-N |
| XLogP | 8.05 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.65 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|