C30H23N5S — CID 4139929
2-N-(cinnamylideneamino)-4-N,5-N,3-triphenyl-1,3-thiazolidine-2,4,5-triimine (PubChem CID 4139929) has the molecular formula C30H23N5S and a molecular weight of 485.62 g/mol. Its IUPAC name is 2-N-(cinnamylideneamino)-4-N,5-N,3-triphenyl-1,3-thiazolidine-2,4,5-triimine.
| Compound Name | 2-N-(cinnamylideneamino)-4-N,5-N,3-triphenyl-1,3-thiazolidine-2,4,5-triimine |
|---|---|
| PubChem CID | 4139929 |
| Molecular Formula | C30H23N5S |
| Molecular Weight | 485.62 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | 2-N-(cinnamylideneamino)-4-N,5-N,3-triphenyl-1,3-thiazolidine-2,4,5-triimine |
| SMILES | C(=Cc1ccccc1)C=NN=C1SC(=N\c2ccccc2)/C(=N\c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C30H23N5S/c1-5-14-24(15-6-1)16-13-23-31-34-30-35(27-21-11-4-12-22-27)28(32-25-17-7-2-8-18-25)29(36-30)33-26-19-9-3-10-20-26/h1-23H/b16-13?,31-23?,32-28+,33-29-,34-30? |
| InChIKey | OPKGOUHTZCFBTC-YWEGJOIKSA-N |
| XLogP | 7.76 |
| TPSA | 52.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.62 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_imine_B(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|