C24H18BrN3O2S — CID 16628453
(2Z,5Z)-5-[(4-bromophenyl)methylidene]-3-(furan-2-ylmethyl)-2-[(E)-[(E)-3-phenylprop-2-enylidene]hydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 16628453) has the molecular formula C24H18BrN3O2S and a molecular weight of 492.40 g/mol. Its IUPAC name is (2Z,5Z)-5-[(4-bromophenyl)methylidene]-3-(furan-2-ylmethyl)-2-[(E)-[(E)-3-phenylprop-2-enylidene]hydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5Z)-5-[(4-bromophenyl)methylidene]-3-(furan-2-ylmethyl)-2-[(E)-[(E)-3-phenylprop-2-enylidene]hydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 16628453 |
| Molecular Formula | C24H18BrN3O2S |
| Molecular Weight | 492.40 g/mol |
| Exact Mass | 491.03 |
| IUPAC Name | (2Z,5Z)-5-[(4-bromophenyl)methylidene]-3-(furan-2-ylmethyl)-2-[(E)-[(E)-3-phenylprop-2-enylidene]hydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2ccc(Br)cc2)S/C(=N\N=C\C=C\c2ccccc2)N1Cc1ccco1 |
| InChI | InChI=1S/C24H18BrN3O2S/c25-20-12-10-19(11-13-20)16-22-23(29)28(17-21-9-5-15-30-21)24(31-22)27-26-14-4-8-18-6-2-1-3-7-18/h1-16H,17H2/b8-4+,22-16-,26-14+,27-24- |
| InChIKey | VWRTVYBDBHWOKB-ODSBBRAQSA-N |
| XLogP | 6.21 |
| TPSA | 58.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.40 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_imine_B(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|