C21H16N4O2S — CID 19246108
(2E,5Z)-5-benzylidene-3-(furan-2-ylmethyl)-2-[(Z)-pyridin-3-ylmethylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 19246108) has the molecular formula C21H16N4O2S and a molecular weight of 388.45 g/mol. Its IUPAC name is (2E,5Z)-5-benzylidene-3-(furan-2-ylmethyl)-2-[(Z)-pyridin-3-ylmethylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-5-benzylidene-3-(furan-2-ylmethyl)-2-[(Z)-pyridin-3-ylmethylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 19246108 |
| Molecular Formula | C21H16N4O2S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | (2E,5Z)-5-benzylidene-3-(furan-2-ylmethyl)-2-[(Z)-pyridin-3-ylmethylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2ccccc2)S/C(=N/N=C\c2cccnc2)N1Cc1ccco1 |
| InChI | InChI=1S/C21H16N4O2S/c26-20-19(12-16-6-2-1-3-7-16)28-21(25(20)15-18-9-5-11-27-18)24-23-14-17-8-4-10-22-13-17/h1-14H,15H2/b19-12-,23-14-,24-21+ |
| InChIKey | XSNKMVRQNPLVJF-FGWFFSPGSA-N |
| XLogP | 4.18 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|