C21H15N5O4S — CID 19246134
(2E,5Z)-3-(furan-2-ylmethyl)-5-[(3-nitrophenyl)methylidene]-2-[(Z)-pyridin-3-ylmethylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 19246134) has the molecular formula C21H15N5O4S and a molecular weight of 433.45 g/mol. Its IUPAC name is (2E,5Z)-3-(furan-2-ylmethyl)-5-[(3-nitrophenyl)methylidene]-2-[(Z)-pyridin-3-ylmethylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-3-(furan-2-ylmethyl)-5-[(3-nitrophenyl)methylidene]-2-[(Z)-pyridin-3-ylmethylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 19246134 |
| Molecular Formula | C21H15N5O4S |
| Molecular Weight | 433.45 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | (2E,5Z)-3-(furan-2-ylmethyl)-5-[(3-nitrophenyl)methylidene]-2-[(Z)-pyridin-3-ylmethylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2cccc([N+](=O)[O-])c2)S/C(=N/N=C\c2cccnc2)N1Cc1ccco1 |
| InChI | InChI=1S/C21H15N5O4S/c27-20-19(11-15-4-1-6-17(10-15)26(28)29)31-21(25(20)14-18-7-3-9-30-18)24-23-13-16-5-2-8-22-12-16/h1-13H,14H2/b19-11-,23-13-,24-21+ |
| InChIKey | VWPQISBEEWYVRF-QCUMUHRLSA-N |
| XLogP | 4.09 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|