C30H24N6S2 — CID 22307062
methyl (NE)-N'-[(E)-benzylideneamino]-N-[3-phenyl-4,5-bis(phenylimino)-1,3-thiazolidin-2-ylidene]carbamimidothioate (PubChem CID 22307062) has the molecular formula C30H24N6S2 and a molecular weight of 532.70 g/mol. Its IUPAC name is methyl (NE)-N'-[(E)-benzylideneamino]-N-[3-phenyl-4,5-bis(phenylimino)-1,3-thiazolidin-2-ylidene]carbamimidothioate.
| Compound Name | methyl (NE)-N'-[(E)-benzylideneamino]-N-[3-phenyl-4,5-bis(phenylimino)-1,3-thiazolidin-2-ylidene]carbamimidothioate |
|---|---|
| PubChem CID | 22307062 |
| Molecular Formula | C30H24N6S2 |
| Molecular Weight | 532.70 g/mol |
| Exact Mass | 532.15 |
| IUPAC Name | methyl (NE)-N'-[(E)-benzylideneamino]-N-[3-phenyl-4,5-bis(phenylimino)-1,3-thiazolidin-2-ylidene]carbamimidothioate |
| SMILES | CSC(=N/N=C/c1ccccc1)/N=C1/SC(=N\c2ccccc2)/C(=N\c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C30H24N6S2/c1-37-29(35-31-22-23-14-6-2-7-15-23)34-30-36(26-20-12-5-13-21-26)27(32-24-16-8-3-9-17-24)28(38-30)33-25-18-10-4-11-19-25/h2-22H,1H3/b31-22+,32-27+,33-28-,34-30+,35-29+ |
| InChIKey | UKERFJCBDDAYLK-FRUHOKAUSA-N |
| XLogP | 7.81 |
| TPSA | 65.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.70 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|