C24H22N6O3S — CID 20844068
4-[(2Z)-2-(dimethylcarbamoylimino)-4,5-bis(phenylimino)-1,3-thiazolidin-3-yl]-N-hydroxybenzeneamine oxide (PubChem CID 20844068) has the molecular formula C24H22N6O3S and a molecular weight of 474.55 g/mol. Its IUPAC name is 4-[(2Z)-2-(dimethylcarbamoylimino)-4,5-bis(phenylimino)-1,3-thiazolidin-3-yl]-N-hydroxybenzeneamine oxide.
| Compound Name | 4-[(2Z)-2-(dimethylcarbamoylimino)-4,5-bis(phenylimino)-1,3-thiazolidin-3-yl]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 20844068 |
| Molecular Formula | C24H22N6O3S |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 4-[(2Z)-2-(dimethylcarbamoylimino)-4,5-bis(phenylimino)-1,3-thiazolidin-3-yl]-N-hydroxybenzeneamine oxide |
| SMILES | CN(C)C(=O)/N=C1\SC(=N\c2ccccc2)/C(=N\c2ccccc2)N1c1ccc([NH+]([O-])O)cc1 |
| InChI | InChI=1S/C24H22N6O3S/c1-28(2)23(31)27-24-29(19-13-15-20(16-14-19)30(32)33)21(25-17-9-5-3-6-10-17)22(34-24)26-18-11-7-4-8-12-18/h3-16,30,32H,1-2H3/b25-21+,26-22-,27-24- |
| InChIKey | MGRKGQDEXAGEFV-NVVCTSCSSA-N |
| XLogP | 4.14 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|