C28H20FN5OS — CID 135789765
2-[(Z)-[(E)-[3-(4-fluorophenyl)-4,5-bis(phenylimino)-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenol (PubChem CID 135789765) has the molecular formula C28H20FN5OS and a molecular weight of 493.57 g/mol. Its IUPAC name is 2-[(Z)-[(E)-[3-(4-fluorophenyl)-4,5-bis(phenylimino)-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenol.
| Compound Name | 2-[(Z)-[(E)-[3-(4-fluorophenyl)-4,5-bis(phenylimino)-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135789765 |
| Molecular Formula | C28H20FN5OS |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | 2-[(Z)-[(E)-[3-(4-fluorophenyl)-4,5-bis(phenylimino)-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenol |
| SMILES | Oc1ccccc1/C=N\N=C1\SC(=N\c2ccccc2)/C(=N\c2ccccc2)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C28H20FN5OS/c29-21-15-17-24(18-16-21)34-26(31-22-10-3-1-4-11-22)27(32-23-12-5-2-6-13-23)36-28(34)33-30-19-20-9-7-8-14-25(20)35/h1-19,35H/b30-19-,31-26+,32-27-,33-28+ |
| InChIKey | HLJPAHWUDPWHOE-OYWOCPLNSA-N |
| XLogP | 6.93 |
| TPSA | 72.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|