C28H21N5O2S — CID 135789763
4-[(E)-[(E)-[3-phenyl-4,5-bis(phenylimino)-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]benzene-1,3-diol (PubChem CID 135789763) has the molecular formula C28H21N5O2S and a molecular weight of 491.58 g/mol. Its IUPAC name is 4-[(E)-[(E)-[3-phenyl-4,5-bis(phenylimino)-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]benzene-1,3-diol.
| Compound Name | 4-[(E)-[(E)-[3-phenyl-4,5-bis(phenylimino)-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 135789763 |
| Molecular Formula | C28H21N5O2S |
| Molecular Weight | 491.58 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | 4-[(E)-[(E)-[3-phenyl-4,5-bis(phenylimino)-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]benzene-1,3-diol |
| SMILES | Oc1ccc(/C=N/N=C2/SC(=N\c3ccccc3)/C(=N\c3ccccc3)N2c2ccccc2)c(O)c1 |
| InChI | InChI=1S/C28H21N5O2S/c34-24-17-16-20(25(35)18-24)19-29-32-28-33(23-14-8-3-9-15-23)26(30-21-10-4-1-5-11-21)27(36-28)31-22-12-6-2-7-13-22/h1-19,34-35H/b29-19+,30-26+,31-27-,32-28+ |
| InChIKey | AUAAPPAJFQUMBN-JEOZODGNSA-N |
| XLogP | 6.50 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.58 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|