C26H19N3 — CID 10785572
1-N,3-N,2-triphenylisoindole-1,3-diimine (PubChem CID 10785572) has the molecular formula C26H19N3 and a molecular weight of 373.46 g/mol. Its IUPAC name is 1-N,3-N,2-triphenylisoindole-1,3-diimine.
| Compound Name | 1-N,3-N,2-triphenylisoindole-1,3-diimine |
|---|---|
| PubChem CID | 10785572 |
| Molecular Formula | C26H19N3 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 1-N,3-N,2-triphenylisoindole-1,3-diimine |
| SMILES | c1ccc(/N=C2\c3ccccc3/C(=N\c3ccccc3)N2c2ccccc2)cc1 |
| InChI | InChI=1S/C26H19N3/c1-4-12-20(13-5-1)27-25-23-18-10-11-19-24(23)26(28-21-14-6-2-7-15-21)29(25)22-16-8-3-9-17-22/h1-19H/b27-25+,28-26+ |
| InChIKey | WLZACDPNOYXBGJ-NBHCHVEOSA-N |
| XLogP | 6.36 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|