C30H29F6N3 — CID 122364903
3-N-octyl-1-N,2-bis[4-(trifluoromethyl)phenyl]isoindole-1,3-diimine (PubChem CID 122364903) has the molecular formula C30H29F6N3 and a molecular weight of 545.57 g/mol. Its IUPAC name is 3-N-octyl-1-N,2-bis[4-(trifluoromethyl)phenyl]isoindole-1,3-diimine.
| Compound Name | 3-N-octyl-1-N,2-bis[4-(trifluoromethyl)phenyl]isoindole-1,3-diimine |
|---|---|
| PubChem CID | 122364903 |
| Molecular Formula | C30H29F6N3 |
| Molecular Weight | 545.57 g/mol |
| Exact Mass | 545.23 |
| IUPAC Name | 3-N-octyl-1-N,2-bis[4-(trifluoromethyl)phenyl]isoindole-1,3-diimine |
| SMILES | CCCCCCCC/N=C1\c2ccccc2/C(=N\c2ccc(C(F)(F)F)cc2)N1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C30H29F6N3/c1-2-3-4-5-6-9-20-37-27-25-10-7-8-11-26(25)28(38-23-16-12-21(13-17-23)29(31,32)33)39(27)24-18-14-22(15-19-24)30(34,35)36/h7-8,10-19H,2-6,9,20H2,1H3/b37-27+,38-28+ |
| InChIKey | CAFFKZQDKKWPFS-RIGUPBQNSA-N |
| XLogP | 9.43 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.57 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|