C21H20N4 — CID 137242858
N,1,4-triphenyl-1,2,4-triazinan-3-imine (PubChem CID 137242858) has the molecular formula C21H20N4 and a molecular weight of 328.42 g/mol. Its IUPAC name is N,1,4-triphenyl-1,2,4-triazinan-3-imine.
| Compound Name | N,1,4-triphenyl-1,2,4-triazinan-3-imine |
|---|---|
| PubChem CID | 137242858 |
| Molecular Formula | C21H20N4 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | N,1,4-triphenyl-1,2,4-triazinan-3-imine |
| SMILES | c1ccc(/N=C2\NN(c3ccccc3)CCN2c2ccccc2)cc1 |
| InChI | InChI=1S/C21H20N4/c1-4-10-18(11-5-1)22-21-23-25(20-14-8-3-9-15-20)17-16-24(21)19-12-6-2-7-13-19/h1-15H,16-17H2,(H,22,23) |
| InChIKey | UULAUDJZMYRSDJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|