About CID 146681754
CID 146681754 (PubChem CID 146681754) has the molecular formula C20H18N4+
and a molecular weight of 314.39 g/mol.
Molecular Properties
| Compound Name | CID 146681754 |
| PubChem CID | 146681754 |
| Molecular Formula | C20H18N4+ |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | — |
| SMILES | c1ccc(/N=C2\NN(c3ccccc3)C[N+]2c2ccccc2)cc1 |
| InChI | InChI=1S/C20H18N4/c1-4-10-17(11-5-1)21-20-22-24(19-14-8-3-9-15-19)16-23(20)18-12-6-2-7-13-18/h1-15H,16H2,(H,21,22)/q+1 |
| InChIKey | KTIJZDWVSPAXNJ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 33.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 146681754 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 146681754?
The IUPAC name of CID 146681754 (CID 146681754) is not available.
What is the SMILES notation for CID 146681754?
The canonical SMILES for CID 146681754 is c1ccc(/N=C2\NN(c3ccccc3)C[N+]2c2ccccc2)cc1.
What is the InChIKey of CID 146681754?
The InChIKey is KTIJZDWVSPAXNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N4/c1-4-10-17(11-5-1)21-20-22-24(19-14-8-3-9-15-19)16-23(20)18-12-6-2-7-13-18/h1-15H,16H2,(H,21,22)/q+1.
What are the key properties of CID 146681754?
CID 146681754 has a molecular weight of 314.39 g/mol, XLogP of 4.13, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 146681754 is sourced from PubChem (CID 146681754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).