C16H12N2O2 — CID 57166178
1-phenyl-3-phenyliminopyrrolidine-2,5-dione (PubChem CID 57166178) has the molecular formula C16H12N2O2 and a molecular weight of 264.28 g/mol. Its IUPAC name is 1-phenyl-3-phenyliminopyrrolidine-2,5-dione.
| Compound Name | 1-phenyl-3-phenyliminopyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 57166178 |
| Molecular Formula | C16H12N2O2 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 1-phenyl-3-phenyliminopyrrolidine-2,5-dione |
| SMILES | O=C1C/C(=N\c2ccccc2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C16H12N2O2/c19-15-11-14(17-12-7-3-1-4-8-12)16(20)18(15)13-9-5-2-6-10-13/h1-10H,11H2/b17-14+ |
| InChIKey | QHYVFVRWVDKCIK-SAPNQHFASA-N |
| XLogP | 2.72 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|