C18H12N2O2 — CID 20617881
2,6-dioxo-1,4-diphenyl-3H-pyridine-5-carbonitrile (PubChem CID 20617881) has the molecular formula C18H12N2O2 and a molecular weight of 288.31 g/mol. Its IUPAC name is 2,6-dioxo-1,4-diphenyl-3H-pyridine-5-carbonitrile.
| Compound Name | 2,6-dioxo-1,4-diphenyl-3H-pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 20617881 |
| Molecular Formula | C18H12N2O2 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 2,6-dioxo-1,4-diphenyl-3H-pyridine-5-carbonitrile |
| SMILES | N#CC1=C(c2ccccc2)CC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C18H12N2O2/c19-12-16-15(13-7-3-1-4-8-13)11-17(21)20(18(16)22)14-9-5-2-6-10-14/h1-10H,11H2 |
| InChIKey | CHAXJPGFYQSBHA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|