C20H13ClN2O2 — CID 134106536
(5E)-5-[(2-chlorophenyl)methylidene]-4-methyl-2,6-dioxo-1-phenylpyridine-3-carbonitrile (PubChem CID 134106536) has the molecular formula C20H13ClN2O2 and a molecular weight of 348.79 g/mol. Its IUPAC name is (5E)-5-[(2-chlorophenyl)methylidene]-4-methyl-2,6-dioxo-1-phenylpyridine-3-carbonitrile.
| Compound Name | (5E)-5-[(2-chlorophenyl)methylidene]-4-methyl-2,6-dioxo-1-phenylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 134106536 |
| Molecular Formula | C20H13ClN2O2 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | (5E)-5-[(2-chlorophenyl)methylidene]-4-methyl-2,6-dioxo-1-phenylpyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)C(=O)N(c2ccccc2)C(=O)/C1=C/c1ccccc1Cl |
| InChI | InChI=1S/C20H13ClN2O2/c1-13-16(11-14-7-5-6-10-18(14)21)19(24)23(20(25)17(13)12-22)15-8-3-2-4-9-15/h2-11H,1H3/b16-11+ |
| InChIKey | QPNZKINHFLTFEV-LFIBNONCSA-N |
| XLogP | 4.14 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|