C22H17ClN2O2S — CID 19113377
(5E)-1-[(2-chlorophenyl)methyl]-4-methyl-5-[(4-methylsulfanylphenyl)methylidene]-2,6-dioxopyridine-3-carbonitrile (PubChem CID 19113377) has the molecular formula C22H17ClN2O2S and a molecular weight of 408.91 g/mol. Its IUPAC name is (5E)-1-[(2-chlorophenyl)methyl]-4-methyl-5-[(4-methylsulfanylphenyl)methylidene]-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5E)-1-[(2-chlorophenyl)methyl]-4-methyl-5-[(4-methylsulfanylphenyl)methylidene]-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19113377 |
| Molecular Formula | C22H17ClN2O2S |
| Molecular Weight | 408.91 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | (5E)-1-[(2-chlorophenyl)methyl]-4-methyl-5-[(4-methylsulfanylphenyl)methylidene]-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CSc1ccc(/C=C2/C(=O)N(Cc3ccccc3Cl)C(=O)C(C#N)=C2C)cc1 |
| InChI | InChI=1S/C22H17ClN2O2S/c1-14-18(11-15-7-9-17(28-2)10-8-15)21(26)25(22(27)19(14)12-24)13-16-5-3-4-6-20(16)23/h3-11H,13H2,1-2H3/b18-11+ |
| InChIKey | BSZKSTKUTPAUIU-WOJGMQOQSA-N |
| XLogP | 4.85 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.91 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|