C21H14N4OS2 — CID 132560313
3-phenyl-5-(4-phenyldiazenylphenyl)imino-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 132560313) has the molecular formula C21H14N4OS2 and a molecular weight of 402.50 g/mol. Its IUPAC name is 3-phenyl-5-(4-phenyldiazenylphenyl)imino-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-phenyl-5-(4-phenyldiazenylphenyl)imino-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 132560313 |
| Molecular Formula | C21H14N4OS2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | 3-phenyl-5-(4-phenyldiazenylphenyl)imino-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=N/c2ccc(/N=N/c3ccccc3)cc2)SC(=S)N1c1ccccc1 |
| InChI | InChI=1S/C21H14N4OS2/c26-20-19(28-21(27)25(20)18-9-5-2-6-10-18)22-15-11-13-17(14-12-15)24-23-16-7-3-1-4-8-16/h1-14H/b22-19-,24-23+ |
| InChIKey | MPYVKJBXFANZLJ-BILNYTLASA-N |
| XLogP | 6.20 |
| TPSA | 57.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|