C16H18N2O3 — CID 163578199
benzene-1,4-diol;4-methyl-1-phenylpyrazolidin-3-one (PubChem CID 163578199) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is benzene-1,4-diol;4-methyl-1-phenylpyrazolidin-3-one.
| Compound Name | benzene-1,4-diol;4-methyl-1-phenylpyrazolidin-3-one |
|---|---|
| PubChem CID | 163578199 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | benzene-1,4-diol;4-methyl-1-phenylpyrazolidin-3-one |
| SMILES | CC1CN(c2ccccc2)NC1=O.Oc1ccc(O)cc1 |
| InChI | InChI=1S/C10H12N2O.C6H6O2/c1-8-7-12(11-10(8)13)9-5-3-2-4-6-9;7-5-1-2-6(8)4-3-5/h2-6,8H,7H2,1H3,(H,11,13);1-4,7-8H |
| InChIKey | GFIWXLPJOFXZEI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|