C11H15N3O2 — CID 10560937
4-methoxy-5-methyl-1-phenyl-1,2,4-triazinan-3-one (PubChem CID 10560937) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is 4-methoxy-5-methyl-1-phenyl-1,2,4-triazinan-3-one.
| Compound Name | 4-methoxy-5-methyl-1-phenyl-1,2,4-triazinan-3-one |
|---|---|
| PubChem CID | 10560937 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 4-methoxy-5-methyl-1-phenyl-1,2,4-triazinan-3-one |
| SMILES | CON1C(=O)NN(c2ccccc2)CC1C |
| InChI | InChI=1S/C11H15N3O2/c1-9-8-13(10-6-4-3-5-7-10)12-11(15)14(9)16-2/h3-7,9H,8H2,1-2H3,(H,12,15) |
| InChIKey | NHZWOZFSPHXVPW-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |