C13H22N2O2 — CID 159587587
methane;4-(methoxymethyl)-1-phenylpyrazolidin-3-one (PubChem CID 159587587) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is methane;4-(methoxymethyl)-1-phenylpyrazolidin-3-one.
| Compound Name | methane;4-(methoxymethyl)-1-phenylpyrazolidin-3-one |
|---|---|
| PubChem CID | 159587587 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | methane;4-(methoxymethyl)-1-phenylpyrazolidin-3-one |
| SMILES | C.C.COCC1CN(c2ccccc2)NC1=O |
| InChI | InChI=1S/C11H14N2O2.2CH4/c1-15-8-9-7-13(12-11(9)14)10-5-3-2-4-6-10;;/h2-6,9H,7-8H2,1H3,(H,12,14);2*1H4 |
| InChIKey | MJUYMJHZEGBGRP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |