C27H20N2OS — CID 10526162
3,5,5-triphenyl-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 10526162) has the molecular formula C27H20N2OS and a molecular weight of 420.54 g/mol. Its IUPAC name is 3,5,5-triphenyl-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | 3,5,5-triphenyl-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 10526162 |
| Molecular Formula | C27H20N2OS |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 3,5,5-triphenyl-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | O=C1N(c2ccccc2)/C(=N/c2ccccc2)SC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H20N2OS/c30-25-27(21-13-5-1-6-14-21,22-15-7-2-8-16-22)31-26(28-23-17-9-3-10-18-23)29(25)24-19-11-4-12-20-24/h1-20H/b28-26- |
| InChIKey | QXZMDSRZYZNPGP-SGEDCAFJSA-N |
| XLogP | 6.40 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|